CAS 149769-84-6 appears in our catalog under these names: Aziridine, 1–((4–methylphenyl)sulfonyl)–2–phenyl–, (2S)–, (S)-1-[(4-Methylphenyl)sulfonyl]-2-phenylaziridine. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg.
(2S)-1-(4-methylphenyl)sulfonyl-2-phenylaziridine (CAS 149769-84-6) is a chemical compound with the molecular formula C15H15NO2S and a molecular weight of 273.4 g/mol. IUPAC name: (2S)-1-(4-methylphenyl)sulfonyl-2-phenylaziridine. InChIKey: KUWCTOOXSUPLAW-AAFJCEBUSA-N.
| Molecular formula | C15H15NO2S |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | (2S)-1-(4-methylphenyl)sulfonyl-2-phenylaziridine |
| InChIKey | KUWCTOOXSUPLAW-AAFJCEBUSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C[C@@H]2C3=CC=CC=C3 |
Computed by PubChem (NCBI)