CAS 62596-62-7 is the registry number for R–1–((4–Methylphenyl)sulfonyl)–2––phenyl–Aziridine. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
1-(4-methylphenyl)sulfonyl-2-phenylaziridine (CAS 62596-62-7) is a chemical compound with the molecular formula C15H15NO2S and a molecular weight of 273.4 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-2-phenylaziridine. InChIKey: KUWCTOOXSUPLAW-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2S |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-2-phenylaziridine |
| InChIKey | KUWCTOOXSUPLAW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC2C3=CC=CC=C3 |
Computed by PubChem (NCBI)