CAS 149818-98-4 is the registry number for Methyl (R)-3-((1,1'-Biphenyl)-4-yl)-2-((tert-butoxycarbonyl)amino)propanoate. Offered by: TRC. Available pack sizes: 1g.
Methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenylphenyl)propanoate (CAS 149818-98-4) is a chemical compound with the molecular formula C21H25NO4 and a molecular weight of 355.4 g/mol. IUPAC name: methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenylphenyl)propanoate. InChIKey: XJFJKCSCNLXBCY-GOSISDBHSA-N.
| Molecular formula | C21H25NO4 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenylphenyl)propanoate |
| InChIKey | XJFJKCSCNLXBCY-GOSISDBHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)C2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)