Products 1498207-35-4

CAS 1498207-35-4 is the registry number for Ethyl 2-amino-3-(4-chloro-3-fluorophenyl)-3-hydroxypropanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-3-(4-chloro-3-fluorophenyl)-3-hydroxypropanoate (CAS 1498207-35-4) is a chemical compound with the molecular formula C11H13ClFNO3 and a molecular weight of 261.68 g/mol. IUPAC name: ethyl 2-amino-3-(4-chloro-3-fluorophenyl)-3-hydroxypropanoate. InChIKey: YKXIZWFYORNKLW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClFNO3
Molecular weight261.68 g/mol
IUPAC nameethyl 2-amino-3-(4-chloro-3-fluorophenyl)-3-hydroxypropanoate
InChIKeyYKXIZWFYORNKLW-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(C1=CC(=C(C=C1)Cl)F)O)N

Computed by PubChem (NCBI)