CAS 2755723-66-9 is the registry number for 3-(4-Chloro-2-fluorophenyl)-3-hydroxy-N-methoxy-N-methylpropanamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
3-(4-chloro-2-fluorophenyl)-3-hydroxy-N-methoxy-N-methylpropanamide (CAS 2755723-66-9) is a chemical compound with the molecular formula C11H13ClFNO3 and a molecular weight of 261.68 g/mol. IUPAC name: 3-(4-chloro-2-fluorophenyl)-3-hydroxy-N-methoxy-N-methylpropanamide. InChIKey: IVVOZBGFQZLMPL-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFNO3 |
|---|---|
| Molecular weight | 261.68 g/mol |
| IUPAC name | 3-(4-chloro-2-fluorophenyl)-3-hydroxy-N-methoxy-N-methylpropanamide |
| InChIKey | IVVOZBGFQZLMPL-UHFFFAOYSA-N |
| SMILES | CN(C(=O)CC(C1=C(C=C(C=C1)Cl)F)O)OC |
Computed by PubChem (NCBI)