Products 2883725-94-6
CAS 2883725-94-6 is the registry number for tert-Butyl (3-chloro-2-fluoro-4-hydroxyphenyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(3-chloro-2-fluoro-4-hydroxyphenyl)carbamate (CAS 2883725-94-6) is a chemical compound with the molecular formula C11H13ClFNO3 and a molecular weight of 261.68 g/mol. IUPAC name: tert-butyl N-(3-chloro-2-fluoro-4-hydroxyphenyl)carbamate. InChIKey: HVHKDNZONUKSAA-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFNO3 |
|---|---|
| Molecular weight | 261.68 g/mol |
| IUPAC name | tert-butyl N-(3-chloro-2-fluoro-4-hydroxyphenyl)carbamate |
| InChIKey | HVHKDNZONUKSAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C(=C(C=C1)O)Cl)F |
Computed by PubChem (NCBI)