Products 1498294-38-4

CAS 1498294-38-4 is the registry number for 3-Iodo-2-methoxyisonicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-iodo-2-methoxypyridine-4-carboxylic acid (CAS 1498294-38-4) is a chemical compound with the molecular formula C7H6INO3 and a molecular weight of 279.03 g/mol. IUPAC name: 3-iodo-2-methoxypyridine-4-carboxylic acid. InChIKey: FEMMIXJBPVMIGZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6INO3
Molecular weight279.03 g/mol
IUPAC name3-iodo-2-methoxypyridine-4-carboxylic acid
InChIKeyFEMMIXJBPVMIGZ-UHFFFAOYSA-N
SMILESCOC1=NC=CC(=C1I)C(=O)O

Computed by PubChem (NCBI)