CAS 1498333-89-3 is the registry number for 3-(Fmoc-aminomethyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
9H-fluoren-9-ylmethyl N-(pyridin-3-ylmethyl)carbamate (CAS 1498333-89-3) is a chemical compound with the molecular formula C21H18N2O2 and a molecular weight of 330.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(pyridin-3-ylmethyl)carbamate. InChIKey: HIELIWLCJOQJFQ-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O2 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(pyridin-3-ylmethyl)carbamate |
| InChIKey | HIELIWLCJOQJFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CN=CC=C4 |
Computed by PubChem (NCBI)