CAS 149854-37-5 appears in our catalog under these names: [1-Methyl-1-(1-naphthyl)ethyl]amine hydrochloride, 95%, (1-Methyl-1-(naphth-1-yl)ethyl)amine Hydrochloride, 2-(Naphthalen-1-yl)propan-2-amine hydrochloride. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 250mg, 1g, 0,25g.
2-naphthalen-1-ylpropan-2-amine;hydrochloride (CAS 149854-37-5) is a chemical compound with the molecular formula C13H16ClN and a molecular weight of 221.72 g/mol. IUPAC name: 2-naphthalen-1-ylpropan-2-amine;hydrochloride. InChIKey: ZOXOBTGYOUSMIA-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | 2-naphthalen-1-ylpropan-2-amine;hydrochloride |
| InChIKey | ZOXOBTGYOUSMIA-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)