Products 36769-06-9
CAS 36769-06-9 is the registry number for 3-Phenyl-8-azabicyclo[3.2.1]oct-2-ene hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-phenyl-8-azabicyclo[3.2.1]oct-2-ene;hydrochloride (CAS 36769-06-9) is a chemical compound with the molecular formula C13H16ClN and a molecular weight of 221.72 g/mol. IUPAC name: 3-phenyl-8-azabicyclo[3.2.1]oct-2-ene;hydrochloride. InChIKey: TZGUPDAZDDSXHN-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | 3-phenyl-8-azabicyclo[3.2.1]oct-2-ene;hydrochloride |
| InChIKey | TZGUPDAZDDSXHN-UHFFFAOYSA-N |
| SMILES | C1CC2C=C(CC1N2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)