CAS 2102502-57-6 is the registry number for (1R,5S,6R)-3-benzyl-6-(chloromethyl)-3-azabicyclo[3.1.0]hexane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,5R)-3-benzyl-6-(chloromethyl)-3-azabicyclo[3.1.0]hexane (CAS 2102502-57-6) is a chemical compound with the molecular formula C13H16ClN and a molecular weight of 221.72 g/mol. IUPAC name: (1S,5R)-3-benzyl-6-(chloromethyl)-3-azabicyclo[3.1.0]hexane. InChIKey: SDWJOFQWLNAKPM-YHWZYXNKSA-N.
| Molecular formula | C13H16ClN |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | (1S,5R)-3-benzyl-6-(chloromethyl)-3-azabicyclo[3.1.0]hexane |
| InChIKey | SDWJOFQWLNAKPM-YHWZYXNKSA-N |
| SMILES | C1[C@@H]2[C@@H](C2CCl)CN1CC3=CC=CC=C3 |
Computed by PubChem (NCBI)