Products 1499161-71-5
CAS 1499161-71-5 is the registry number for 4,4'-(Ethyne-1,2-diyl)bis(2-nitroaniline), 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-[2-(4-amino-3-nitrophenyl)ethynyl]-2-nitroaniline (CAS 1499161-71-5) is a chemical compound with the molecular formula C14H10N4O4 and a molecular weight of 298.25 g/mol. IUPAC name: 4-[2-(4-amino-3-nitrophenyl)ethynyl]-2-nitroaniline. InChIKey: YZOQWYBZVLQVCE-UHFFFAOYSA-N.
| Molecular formula | C14H10N4O4 |
|---|---|
| Molecular weight | 298.25 g/mol |
| IUPAC name | 4-[2-(4-amino-3-nitrophenyl)ethynyl]-2-nitroaniline |
| InChIKey | YZOQWYBZVLQVCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#CC2=CC(=C(C=C2)N)[N+](=O)[O-])[N+](=O)[O-])N |
Computed by PubChem (NCBI)