CAS 86832-06-6 appears in our catalog under these names: 4-Nitrobenzyl 1h-benzo[d][1,2,3]triazole-1-carboxylate, 97%, 4-Nitrobenzyl 1H-benzo(d)(1,2,3)triazole-1-carboxylate, 97%, 1-(4-Nitrobenzyloxycarbonyl)benzotriazole, 97%, 97%, 4-Nitrobenzyl 1H-benzo[d][1,2,3]triazole-1-carboxylate, 97%(LC-MS),RG. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g.
(4-nitrophenyl)methyl benzotriazole-1-carboxylate (CAS 86832-06-6) is a chemical compound with the molecular formula C14H10N4O4 and a molecular weight of 298.25 g/mol. IUPAC name: (4-nitrophenyl)methyl benzotriazole-1-carboxylate. InChIKey: MKIHFLQNZUDOQW-UHFFFAOYSA-N.
| Molecular formula | C14H10N4O4 |
|---|---|
| Molecular weight | 298.25 g/mol |
| IUPAC name | (4-nitrophenyl)methyl benzotriazole-1-carboxylate |
| InChIKey | MKIHFLQNZUDOQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=NN2C(=O)OCC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)