CAS 1942879-46-0 appears in our catalog under these names: 2,5–Di(1H–imidazol–1–yl)terephthalic acid, 2,5-Di-1H -Imidazol-1-Yl-1,4-Benzenedicarboxylic Acid, 98%, 98%, 2,5-Di(1H-imidazol-1-yl)terephthalic acid, 98%, 2,5-Di-1H -imidazol-1-yl-1,4-benzenedicarboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
2,5-di(imidazol-1-yl)terephthalic acid (CAS 1942879-46-0) is a chemical compound with the molecular formula C14H10N4O4 and a molecular weight of 298.25 g/mol. IUPAC name: 2,5-di(imidazol-1-yl)terephthalic acid. InChIKey: VJXCLSZDBWNUJU-UHFFFAOYSA-N.
| Molecular formula | C14H10N4O4 |
|---|---|
| Molecular weight | 298.25 g/mol |
| IUPAC name | 2,5-di(imidazol-1-yl)terephthalic acid |
| InChIKey | VJXCLSZDBWNUJU-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)C2=CC(=C(C=C2C(=O)O)N3C=CN=C3)C(=O)O |
Computed by PubChem (NCBI)