Products 1499398-66-1

CAS 1499398-66-1 appears in our catalog under these names: (3-Bromo-5-chlorophenyl)methanesulfonyl chloride, 95%, (3-Bromo-5-chlorophenyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

(3-bromo-5-chlorophenyl)methanesulfonyl chloride (CAS 1499398-66-1) is a chemical compound with the molecular formula C7H5BrCl2O2S and a molecular weight of 303.99 g/mol. IUPAC name: (3-bromo-5-chlorophenyl)methanesulfonyl chloride. InChIKey: DTWYDCMDRNHRAI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrCl2O2S
Molecular weight303.99 g/mol
IUPAC name(3-bromo-5-chlorophenyl)methanesulfonyl chloride
InChIKeyDTWYDCMDRNHRAI-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1Cl)Br)CS(=O)(=O)Cl

Computed by PubChem (NCBI)