Products 2138414-57-8

CAS 2138414-57-8 appears in our catalog under these names: 2-Bromo-6-chloro-4-methylbenzenesulfonyl chloride, 98%, 2-Bromo-6-chloro-4-methylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2-bromo-6-chloro-4-methylbenzenesulfonyl chloride (CAS 2138414-57-8) is a chemical compound with the molecular formula C7H5BrCl2O2S and a molecular weight of 303.99 g/mol. IUPAC name: 2-bromo-6-chloro-4-methylbenzenesulfonyl chloride. InChIKey: UHHSSMVUQCJUFW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrCl2O2S
Molecular weight303.99 g/mol
IUPAC name2-bromo-6-chloro-4-methylbenzenesulfonyl chloride
InChIKeyUHHSSMVUQCJUFW-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)Br)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)