Products 2921904-97-2
CAS 2921904-97-2 is the registry number for 1-bromo-2,4-dichloro-3-(methylsulfonyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2,4-dichloro-3-methylsulfonylbenzene (CAS 2921904-97-2) is a chemical compound with the molecular formula C7H5BrCl2O2S and a molecular weight of 303.99 g/mol. IUPAC name: 1-bromo-2,4-dichloro-3-methylsulfonylbenzene. InChIKey: ZLJSMWVMTYBAJU-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2O2S |
|---|---|
| Molecular weight | 303.99 g/mol |
| IUPAC name | 1-bromo-2,4-dichloro-3-methylsulfonylbenzene |
| InChIKey | ZLJSMWVMTYBAJU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1Cl)Br)Cl |
Computed by PubChem (NCBI)