CAS 1416349-30-8 appears in our catalog under these names: 5-Bromo-4-chloro-2-methylbenzene-1-sulfonyl chloride, 95%, 5-Bromo-4-chloro-2-methylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-bromo-4-chloro-2-methylbenzenesulfonyl chloride (CAS 1416349-30-8) is a chemical compound with the molecular formula C7H5BrCl2O2S and a molecular weight of 303.99 g/mol. IUPAC name: 5-bromo-4-chloro-2-methylbenzenesulfonyl chloride. InChIKey: AIJZUVIOUIHQOE-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2O2S |
|---|---|
| Molecular weight | 303.99 g/mol |
| IUPAC name | 5-bromo-4-chloro-2-methylbenzenesulfonyl chloride |
| InChIKey | AIJZUVIOUIHQOE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)Cl)Br)Cl |
Computed by PubChem (NCBI)