Products 1499807-41-8
CAS 1499807-41-8 is the registry number for 4-((5-Chloropyridin-3-yl)oxy)pyrimidin-2-amine 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-[(5-chloro-3-pyridinyl)oxy]pyrimidin-2-amine (CAS 1499807-41-8) is a chemical compound with the molecular formula C9H7ClN4O and a molecular weight of 222.63 g/mol. IUPAC name: 4-[(5-chloro-3-pyridinyl)oxy]pyrimidin-2-amine. InChIKey: HUCIUIKIXMLXLH-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN4O |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | 4-[(5-chloro-3-pyridinyl)oxy]pyrimidin-2-amine |
| InChIKey | HUCIUIKIXMLXLH-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1OC2=CC(=CN=C2)Cl)N |
Computed by PubChem (NCBI)