CAS 2570190-45-1 is the registry number for 6-Chloro-5-(imidazol-1-yl)pyridine-2-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-chloro-5-imidazol-1-ylpyridine-2-carboxamide (CAS 2570190-45-1) is a chemical compound with the molecular formula C9H7ClN4O and a molecular weight of 222.63 g/mol. IUPAC name: 6-chloro-5-imidazol-1-ylpyridine-2-carboxamide. InChIKey: IHZZBZYWHBCUTF-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN4O |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | 6-chloro-5-imidazol-1-ylpyridine-2-carboxamide |
| InChIKey | IHZZBZYWHBCUTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1N2C=CN=C2)Cl)C(=O)N |
Computed by PubChem (NCBI)