CAS 503860-54-6 is the registry number for [4,4'-Bipyrimidin]-6(1h)-one, 2-chloro-1-methyl-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one (CAS 503860-54-6) is a chemical compound with the molecular formula C9H7ClN4O and a molecular weight of 222.63 g/mol. IUPAC name: 2-chloro-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one. InChIKey: SIXGRHSRZFQWPH-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN4O |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | 2-chloro-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one |
| InChIKey | SIXGRHSRZFQWPH-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C=C(N=C1Cl)C2=NC=NC=C2 |
Computed by PubChem (NCBI)