CAS 150094-69-2 is the registry number for N-(Triphenylmethyl)-D-serine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-3-hydroxy-2-(tritylamino)propanoic acid (CAS 150094-69-2) is a chemical compound with the molecular formula C22H21NO3 and a molecular weight of 347.4 g/mol. IUPAC name: (2R)-3-hydroxy-2-(tritylamino)propanoic acid. InChIKey: CAXCRXDCRBCENL-HXUWFJFHSA-N.
| Molecular formula | C22H21NO3 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | (2R)-3-hydroxy-2-(tritylamino)propanoic acid |
| InChIKey | CAXCRXDCRBCENL-HXUWFJFHSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N[C@H](CO)C(=O)O |
Computed by PubChem (NCBI)