Products 150094-69-2

CAS 150094-69-2 is the registry number for N-(Triphenylmethyl)-D-serine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2R)-3-hydroxy-2-(tritylamino)propanoic acid (CAS 150094-69-2) is a chemical compound with the molecular formula C22H21NO3 and a molecular weight of 347.4 g/mol. IUPAC name: (2R)-3-hydroxy-2-(tritylamino)propanoic acid. InChIKey: CAXCRXDCRBCENL-HXUWFJFHSA-N.

Identity
Molecular formulaC22H21NO3
Molecular weight347.4 g/mol
IUPAC name(2R)-3-hydroxy-2-(tritylamino)propanoic acid
InChIKeyCAXCRXDCRBCENL-HXUWFJFHSA-N
SMILESC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N[C@H](CO)C(=O)O

Computed by PubChem (NCBI)