Products 878019-53-5
CAS 878019-53-5 appears in our catalog under these names: Coumberol, Coumberol, 99.99%, Coumberol, 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 25 mg, 50 mg, 100 mg, 5 mg, 10 mg.
6-[hydroxy(phenyl)methyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one (CAS 878019-53-5) is a chemical compound with the molecular formula C22H21NO3 and a molecular weight of 347.4 g/mol. IUPAC name: 6-[hydroxy(phenyl)methyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one. InChIKey: FXBJCIJXXOXALP-UHFFFAOYSA-N.
| Molecular formula | C22H21NO3 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 6-[hydroxy(phenyl)methyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
| InChIKey | FXBJCIJXXOXALP-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(C4=C2N(C1)CCC4)OC(=O)C=C3C(C5=CC=CC=C5)O |
Computed by PubChem (NCBI)
Synonyms:
Coumberol, orb2566605