Products 25840-83-9
CAS 25840-83-9 appears in our catalog under these names: H-L-Ser(Trt)-OH, H-Ser(Trt)-OH, 97% HPLC（contains~5.0% water）, O-Trityl-L-serine, ≥98%, O-Trityl-L-serine, 97% HPLC（contains~5.0% water）. Offered by: Iris Biotech, Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 5g, 25g, 100g.
(2S)-2-amino-3-trityloxypropanoic acid (CAS 25840-83-9) is a chemical compound with the molecular formula C22H21NO3 and a molecular weight of 347.4 g/mol. IUPAC name: (2S)-2-amino-3-trityloxypropanoic acid. InChIKey: ZXVRNLZMMUBFSR-FQEVSTJZSA-N.
| Molecular formula | C22H21NO3 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | (2S)-2-amino-3-trityloxypropanoic acid |
| InChIKey | ZXVRNLZMMUBFSR-FQEVSTJZSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)OC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)