CAS 1501-98-0 appears in our catalog under these names: 1-(1-Adamantyl)methanamine hydrochloride, 96%, 1-Adamantanemethylamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 10g, 25g, 50g, 100g, 250g.
1-adamantylmethanamine;hydrochloride (CAS 1501-98-0) is a chemical compound with the molecular formula C11H20ClN and a molecular weight of 201.73 g/mol. IUPAC name: 1-adamantylmethanamine;hydrochloride. InChIKey: SCNHINHHYKFASL-UHFFFAOYSA-N.
| Molecular formula | C11H20ClN |
|---|---|
| Molecular weight | 201.73 g/mol |
| IUPAC name | 1-adamantylmethanamine;hydrochloride |
| InChIKey | SCNHINHHYKFASL-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)CN.Cl |
Computed by PubChem (NCBI)