Products 2763759-69-7
CAS 2763759-69-7 is the registry number for 3-Cyclohexylbicyclo[1.1.1]pentan-1-amine hydrochloride 95%. Offered by: Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg.
3-cyclohexylbicyclo[1.1.1]pentan-1-amine;hydrochloride (CAS 2763759-69-7) is a chemical compound with the molecular formula C11H20ClN and a molecular weight of 201.73 g/mol. IUPAC name: 3-cyclohexylbicyclo[1.1.1]pentan-1-amine;hydrochloride. InChIKey: IUQOKCSUXHNGRZ-UHFFFAOYSA-N.
| Molecular formula | C11H20ClN |
|---|---|
| Molecular weight | 201.73 g/mol |
| IUPAC name | 3-cyclohexylbicyclo[1.1.1]pentan-1-amine;hydrochloride |
| InChIKey | IUQOKCSUXHNGRZ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C23CC(C2)(C3)N.Cl |
Computed by PubChem (NCBI)