CAS 33103-93-4 appears in our catalog under these names: (3-Methyl-1-adamantyl)amine hydrochloride, 95%, 3-Methyl-1-Aminoadamantane HCl, Demethyl Memantine HCl, Demethyl Memantine Hydrochloride, >95% (HPLC), 3-Methyladamantan-1-amine Hydrochloride (Desmethylmemantine Hydrochloride). Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: 250mg, 1g, 5g, on request, 50mg, 5mg, 4x25mg, 25mg.
3-methyladamantan-1-amine;hydrochloride (CAS 33103-93-4) is a chemical compound with the molecular formula C11H20ClN and a molecular weight of 201.73 g/mol. IUPAC name: 3-methyladamantan-1-amine;hydrochloride. InChIKey: WITBNCXKULHPMW-UHFFFAOYSA-N.
| Molecular formula | C11H20ClN |
|---|---|
| Molecular weight | 201.73 g/mol |
| IUPAC name | 3-methyladamantan-1-amine;hydrochloride |
| InChIKey | WITBNCXKULHPMW-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)CC(C3)(C2)N.Cl |
Computed by PubChem (NCBI)