Products 1501057-36-8
CAS 1501057-36-8 is the registry number for 2-({[(benzyloxy)carbonyl]amino}methyl)pyridine-4-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 1g.
2-(phenylmethoxycarbonylaminomethyl)pyridine-4-carboxylic acid (CAS 1501057-36-8) is a chemical compound with the molecular formula C15H14N2O4 and a molecular weight of 286.28 g/mol. IUPAC name: 2-(phenylmethoxycarbonylaminomethyl)pyridine-4-carboxylic acid. InChIKey: QLIYWKZTKWCBHD-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O4 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | 2-(phenylmethoxycarbonylaminomethyl)pyridine-4-carboxylic acid |
| InChIKey | QLIYWKZTKWCBHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC2=NC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)