Products 1501254-33-6
CAS 1501254-33-6 appears in our catalog under these names: 2-Amino-(1,3)thiazolo(4,5-b)pyridine-6-carboxylic acid, 2-Aminothiazolo[4,5-b]pyridine-6-carboxylic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, BLDpharm. Available pack sizes: 50mg, 0,5g, 250mg, 1g, 100mg.
2-amino-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid (CAS 1501254-33-6) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 2-amino-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid. InChIKey: ZEKKEUQGGWCAPM-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 2-amino-[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid |
| InChIKey | ZEKKEUQGGWCAPM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1SC(=N2)N)C(=O)O |
Computed by PubChem (NCBI)