CAS 150131-21-8 is the registry number for O-Desmethyl Felodipine, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg.
4-(2,3-dichlorophenyl)-5-ethoxycarbonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid (CAS 150131-21-8) is a chemical compound with the molecular formula C17H17Cl2NO4 and a molecular weight of 370.2 g/mol. IUPAC name: 4-(2,3-dichlorophenyl)-5-ethoxycarbonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid. InChIKey: KCIBIAFYYVAYEO-UHFFFAOYSA-N.
| Molecular formula | C17H17Cl2NO4 |
|---|---|
| Molecular weight | 370.2 g/mol |
| IUPAC name | 4-(2,3-dichlorophenyl)-5-ethoxycarbonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid |
| InChIKey | KCIBIAFYYVAYEO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=C(C(=CC=C2)Cl)Cl)C(=O)O)C)C |
Computed by PubChem (NCBI)