CAS 221016-39-3 appears in our catalog under these names: Diclofenac Glyceryl, 2,3-Dihydroxypropyl 2-(2-((2,6-dichlorophenyl)amino)phenyl)acetate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
2,3-dihydroxypropyl 2-[2-(2,6-dichloroanilino)phenyl]acetate (CAS 221016-39-3) is a chemical compound with the molecular formula C17H17Cl2NO4 and a molecular weight of 370.2 g/mol. IUPAC name: 2,3-dihydroxypropyl 2-[2-(2,6-dichloroanilino)phenyl]acetate. InChIKey: OTUGERIPASTWJX-UHFFFAOYSA-N.
| Molecular formula | C17H17Cl2NO4 |
|---|---|
| Molecular weight | 370.2 g/mol |
| IUPAC name | 2,3-dihydroxypropyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| InChIKey | OTUGERIPASTWJX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)OCC(CO)O)NC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)