CAS 86189-69-7 is the registry number for 4-(2,3-Dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic acid ethyl methyl ester. Offered by: Chemat. Available pack sizes: 5g, 25g, 100g.
Dimethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 86189-69-7) is a chemical compound with the molecular formula C17H17Cl2NO4 and a molecular weight of 370.2 g/mol. IUPAC name: dimethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: VEACAIASCBTOFS-UHFFFAOYSA-N.
| Molecular formula | C17H17Cl2NO4 |
|---|---|
| Molecular weight | 370.2 g/mol |
| IUPAC name | dimethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | VEACAIASCBTOFS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC)C2=C(C(=CC=C2)Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)