CAS 15014-20-7 is the registry number for Bis–(4–chlorophenyl)malonate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Bis(4-chlorophenyl) propanedioate (CAS 15014-20-7) is a chemical compound with the molecular formula C15H10Cl2O4 and a molecular weight of 325.1 g/mol. IUPAC name: bis(4-chlorophenyl) propanedioate. InChIKey: UHCPKBPIVUUYHJ-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2O4 |
|---|---|
| Molecular weight | 325.1 g/mol |
| IUPAC name | bis(4-chlorophenyl) propanedioate |
| InChIKey | UHCPKBPIVUUYHJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC(=O)CC(=O)OC2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)