Products 15014-20-7

CAS 15014-20-7 is the registry number for Bis–(4–chlorophenyl)malonate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Bis(4-chlorophenyl) propanedioate (CAS 15014-20-7) is a chemical compound with the molecular formula C15H10Cl2O4 and a molecular weight of 325.1 g/mol. IUPAC name: bis(4-chlorophenyl) propanedioate. InChIKey: UHCPKBPIVUUYHJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H10Cl2O4
Molecular weight325.1 g/mol
IUPAC namebis(4-chlorophenyl) propanedioate
InChIKeyUHCPKBPIVUUYHJ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1OC(=O)CC(=O)OC2=CC=C(C=C2)Cl)Cl

Computed by PubChem (NCBI)