Products 428482-45-5

CAS 428482-45-5 is the registry number for 4-((2,6-Dichloro-4-formylphenoxy)methyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-[(2,6-dichloro-4-formylphenoxy)methyl]benzoic acid (CAS 428482-45-5) is a chemical compound with the molecular formula C15H10Cl2O4 and a molecular weight of 325.1 g/mol. IUPAC name: 4-[(2,6-dichloro-4-formylphenoxy)methyl]benzoic acid. InChIKey: QBTVTKLDIBALGW-UHFFFAOYSA-N.

Identity
Molecular formulaC15H10Cl2O4
Molecular weight325.1 g/mol
IUPAC name4-[(2,6-dichloro-4-formylphenoxy)methyl]benzoic acid
InChIKeyQBTVTKLDIBALGW-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1COC2=C(C=C(C=C2Cl)C=O)Cl)C(=O)O

Computed by PubChem (NCBI)