CAS 321968-49-4 appears in our catalog under these names: 4-Formyl-2-methoxyphenyl 2,4-dichlorobenzoate, 95%, 4-Formyl-2-methoxyphenyl 2,4-dichlorobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(4-formyl-2-methoxyphenyl) 2,4-dichlorobenzoate (CAS 321968-49-4) is a chemical compound with the molecular formula C15H10Cl2O4 and a molecular weight of 325.1 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) 2,4-dichlorobenzoate. InChIKey: MRMHFLRWGHDADP-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2O4 |
|---|---|
| Molecular weight | 325.1 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) 2,4-dichlorobenzoate |
| InChIKey | MRMHFLRWGHDADP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OC(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)