Products 15017-52-4
CAS 15017-52-4 appears in our catalog under these names: 4-Fluoro-3-nitrobenzyl bromide, 98%, 4-(Bromomethyl)-1-fluoro-2-nitrobenzene 98%, Benzene, 4-(bromomethyl)-1-fluoro-2-nitro-, 98%, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 25g, 100g, 5g, 10g.
4-(bromomethyl)-1-fluoro-2-nitrobenzene (CAS 15017-52-4) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 4-(bromomethyl)-1-fluoro-2-nitrobenzene. InChIKey: OAMKMERAYXDUEW-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 4-(bromomethyl)-1-fluoro-2-nitrobenzene |
| InChIKey | OAMKMERAYXDUEW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)[N+](=O)[O-])F |
Computed by PubChem (NCBI)