CAS 150331-35-4 is the registry number for p-DNSB. Offered by: MedChemExpress. Available pack sizes: Get quote.
N,N-dimethyl-4-(6-nitro-1H-inden-2-yl)aniline (CAS 150331-35-4) is a chemical compound with the molecular formula C17H16N2O2 and a molecular weight of 280.32 g/mol. IUPAC name: N,N-dimethyl-4-(6-nitro-1H-inden-2-yl)aniline. InChIKey: YKKQPAOKFSDWOW-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O2 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | N,N-dimethyl-4-(6-nitro-1H-inden-2-yl)aniline |
| InChIKey | YKKQPAOKFSDWOW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC3=C(C2)C=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)