CAS 1503326-58-6 appears in our catalog under these names: Methyl 2-amino-4,4-dimethyl-4H,5H,6H-cyclopenta(b)thiophene-3-carboxylate, 95%, Methyl 2-amino-4,4-dimethyl-4H,5H,6H-cyclopenta(b)thiophene-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 2-amino-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxylate (CAS 1503326-58-6) is a chemical compound with the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. IUPAC name: methyl 2-amino-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxylate. InChIKey: PDECIJZNYOHCLT-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2S |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | methyl 2-amino-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxylate |
| InChIKey | PDECIJZNYOHCLT-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C1C(=C(S2)N)C(=O)OC)C |
Computed by PubChem (NCBI)