Products 1503529-33-6
CAS 1503529-33-6 appears in our catalog under these names: 1–(4–Chlorophenyl)–3–(1–methyl–1H–pyrazol–4–yl)propane–1，3–dione, 1-(4-Chlorophenyl)-3-(1-methyl-1H-pyrazol-4-yl)propane-1,3-dione, 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-(4-chlorophenyl)-3-(1-methylpyrazol-4-yl)propane-1,3-dione (CAS 1503529-33-6) is a chemical compound with the molecular formula C13H11ClN2O2 and a molecular weight of 262.69 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-(1-methylpyrazol-4-yl)propane-1,3-dione. InChIKey: CZSCDJSETTZPLZ-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O2 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-(1-methylpyrazol-4-yl)propane-1,3-dione |
| InChIKey | CZSCDJSETTZPLZ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C(=O)CC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)