CAS 1503590-26-8 is the registry number for N-Benzyl-4-bromo-1,3-thiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-benzyl-4-bromo-1,3-thiazol-2-amine (CAS 1503590-26-8) is a chemical compound with the molecular formula C10H9BrN2S and a molecular weight of 269.16 g/mol. IUPAC name: N-benzyl-4-bromo-1,3-thiazol-2-amine. InChIKey: NOAPLNAFBYNDSJ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2S |
|---|---|
| Molecular weight | 269.16 g/mol |
| IUPAC name | N-benzyl-4-bromo-1,3-thiazol-2-amine |
| InChIKey | NOAPLNAFBYNDSJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC(=CS2)Br |
Computed by PubChem (NCBI)