CAS 1565942-99-5 is the registry number for 4-(3-Bromo-2-methylphenyl)thiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-bromo-2-methylphenyl)-1,3-thiazol-2-amine (CAS 1565942-99-5) is a chemical compound with the molecular formula C10H9BrN2S and a molecular weight of 269.16 g/mol. IUPAC name: 4-(3-bromo-2-methylphenyl)-1,3-thiazol-2-amine. InChIKey: GMNMDPGHTFSWMD-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2S |
|---|---|
| Molecular weight | 269.16 g/mol |
| IUPAC name | 4-(3-bromo-2-methylphenyl)-1,3-thiazol-2-amine |
| InChIKey | GMNMDPGHTFSWMD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Br)C2=CSC(=N2)N |
Computed by PubChem (NCBI)