CAS 1602992-75-5 is the registry number for 5-(2-Bromo-4-methylphenyl)thiazol-2-amine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
5-(2-bromo-4-methylphenyl)-1,3-thiazol-2-amine (CAS 1602992-75-5) is a chemical compound with the molecular formula C10H9BrN2S and a molecular weight of 269.16 g/mol. IUPAC name: 5-(2-bromo-4-methylphenyl)-1,3-thiazol-2-amine. InChIKey: JAJZJNRYSRHTJS-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2S |
|---|---|
| Molecular weight | 269.16 g/mol |
| IUPAC name | 5-(2-bromo-4-methylphenyl)-1,3-thiazol-2-amine |
| InChIKey | JAJZJNRYSRHTJS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CN=C(S2)N)Br |
Computed by PubChem (NCBI)