CAS 923737-16-0 appears in our catalog under these names: 5-((3-Bromophenyl)methyl)-1,3-thiazol-2-amine, 95%, 5-((3-Bromophenyl)methyl)-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-[(3-bromophenyl)methyl]-1,3-thiazol-2-amine (CAS 923737-16-0) is a chemical compound with the molecular formula C10H9BrN2S and a molecular weight of 269.16 g/mol. IUPAC name: 5-[(3-bromophenyl)methyl]-1,3-thiazol-2-amine. InChIKey: QGPGPGCUYYOGGE-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2S |
|---|---|
| Molecular weight | 269.16 g/mol |
| IUPAC name | 5-[(3-bromophenyl)methyl]-1,3-thiazol-2-amine |
| InChIKey | QGPGPGCUYYOGGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CC2=CN=C(S2)N |
Computed by PubChem (NCBI)