CAS 150403-88-6 appears in our catalog under these names: N5-(1-Iminoethyl) L-Ornithine Hydrochloride, >95% (HPLC), (S)–5–Acetimidamido–2–aminopentanoic acid hydrochloride. Offered by: TRC, GLPBio. Available pack sizes: 100mg.
(2S)-2-amino-5-(1-aminoethylideneamino)pentanoic acid;hydrochloride (CAS 150403-88-6) is a chemical compound with the molecular formula C7H16ClN3O2 and a molecular weight of 209.67 g/mol. IUPAC name: (2S)-2-amino-5-(1-aminoethylideneamino)pentanoic acid;hydrochloride. InChIKey: JIBZSGQTCBWUKL-RGMNGODLSA-N.
| Molecular formula | C7H16ClN3O2 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | (2S)-2-amino-5-(1-aminoethylideneamino)pentanoic acid;hydrochloride |
| InChIKey | JIBZSGQTCBWUKL-RGMNGODLSA-N |
| SMILES | CC(=NCCC[C@@H](C(=O)O)N)N.Cl |
Computed by PubChem (NCBI)