Products 36920-56-6
CAS 36920-56-6 is the registry number for H-Val-gly-nh2 hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(2S)-2-amino-N-(2-amino-2-oxoethyl)-3-methylbutanamide;hydrochloride (CAS 36920-56-6) is a chemical compound with the molecular formula C7H16ClN3O2 and a molecular weight of 209.67 g/mol. IUPAC name: (2S)-2-amino-N-(2-amino-2-oxoethyl)-3-methylbutanamide;hydrochloride. InChIKey: SMACEPBFMAVOOZ-RGMNGODLSA-N.
| Molecular formula | C7H16ClN3O2 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | (2S)-2-amino-N-(2-amino-2-oxoethyl)-3-methylbutanamide;hydrochloride |
| InChIKey | SMACEPBFMAVOOZ-RGMNGODLSA-N |
| SMILES | CC(C)[C@@H](C(=O)NCC(=O)N)N.Cl |
Computed by PubChem (NCBI)