CAS 691898-38-1 appears in our catalog under these names: N-Boc-aminomethylamidine Hydrochloride, tert-Butyl (2-amino-2-iminoethyl)carbamate hydrochloride 95%, tert-Butyl (2-amino-2-iminoethyl)carbamate hydrochloride, 95%, 95%, tert-Butyl (2-amino-2-iminoethyl)carbamate hydrochloride, 95%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 25g.
Tert-butyl N-(2-amino-2-iminoethyl)carbamate;hydrochloride (CAS 691898-38-1) is a chemical compound with the molecular formula C7H16ClN3O2 and a molecular weight of 209.67 g/mol. IUPAC name: tert-butyl N-(2-amino-2-iminoethyl)carbamate;hydrochloride. InChIKey: KSWWOLRLNZUAKS-UHFFFAOYSA-N.
| Molecular formula | C7H16ClN3O2 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | tert-butyl N-(2-amino-2-iminoethyl)carbamate;hydrochloride |
| InChIKey | KSWWOLRLNZUAKS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(=N)N.Cl |
Computed by PubChem (NCBI)