Products 15050-03-0
CAS 15050-03-0 appears in our catalog under these names: Ethyl 6-hydroxy-1H-indole-2-carboxylate 95%, Ethyl 6-hydroxy-1H-indole-2-carboxylate, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
Ethyl 6-hydroxy-1H-indole-2-carboxylate (CAS 15050-03-0) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: ethyl 6-hydroxy-1H-indole-2-carboxylate. InChIKey: FVMVBNSCNRLYIJ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | ethyl 6-hydroxy-1H-indole-2-carboxylate |
| InChIKey | FVMVBNSCNRLYIJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=C(C=C2)O |
Computed by PubChem (NCBI)