CAS 150560-60-4 appears in our catalog under these names: 5-Cyclohexyl-2,3-dihydro-1H-indol-2-one, 95%, 5-Cyclohexyl-2,3-dihydro-1H-indol-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-cyclohexyl-1,3-dihydroindol-2-one (CAS 150560-60-4) is a chemical compound with the molecular formula C14H17NO and a molecular weight of 215.29 g/mol. IUPAC name: 5-cyclohexyl-1,3-dihydroindol-2-one. InChIKey: GAMOWVPYWCFRMK-UHFFFAOYSA-N.
| Molecular formula | C14H17NO |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | 5-cyclohexyl-1,3-dihydroindol-2-one |
| InChIKey | GAMOWVPYWCFRMK-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC3=C(C=C2)NC(=O)C3 |
Computed by PubChem (NCBI)