CAS 1505665-00-8 appears in our catalog under these names: Ethyl 4-bromo-5-chloro-2-fluorobenzoate, 95%, Ethyl 4-bromo-5-chloro-2-fluorobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Ethyl 4-bromo-5-chloro-2-fluorobenzoate (CAS 1505665-00-8) is a chemical compound with the molecular formula C9H7BrClFO2 and a molecular weight of 281.50 g/mol. IUPAC name: ethyl 4-bromo-5-chloro-2-fluorobenzoate. InChIKey: UUPTUDXKEGHBEZ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClFO2 |
|---|---|
| Molecular weight | 281.50 g/mol |
| IUPAC name | ethyl 4-bromo-5-chloro-2-fluorobenzoate |
| InChIKey | UUPTUDXKEGHBEZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1F)Br)Cl |
Computed by PubChem (NCBI)