Products 2504204-09-3
CAS 2504204-09-3 appears in our catalog under these names: 2-(5-Bromo-3-chloro-2-fluorophenyl)-1,3-dioxolane, 95%, 2-(5-Bromo-3-chloro-2-fluorophenyl)-1,3-dioxolane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
2-(5-bromo-3-chloro-2-fluorophenyl)-1,3-dioxolane (CAS 2504204-09-3) is a chemical compound with the molecular formula C9H7BrClFO2 and a molecular weight of 281.50 g/mol. IUPAC name: 2-(5-bromo-3-chloro-2-fluorophenyl)-1,3-dioxolane. InChIKey: SXZKXMVECFEKPJ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClFO2 |
|---|---|
| Molecular weight | 281.50 g/mol |
| IUPAC name | 2-(5-bromo-3-chloro-2-fluorophenyl)-1,3-dioxolane |
| InChIKey | SXZKXMVECFEKPJ-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C(=CC(=C2)Br)Cl)F |
Computed by PubChem (NCBI)